C18H19N5O4 — CID 109302944
methyl 4-[[4-(4-formylpiperazine-1-carbonyl)pyrimidin-2-yl]amino]benzoate (PubChem CID 109302944) has the molecular formula C18H19N5O4 and a molecular weight of 369.38 g/mol. Its IUPAC name is methyl 4-[[4-(4-formylpiperazine-1-carbonyl)pyrimidin-2-yl]amino]benzoate.
| Compound Name | methyl 4-[[4-(4-formylpiperazine-1-carbonyl)pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 109302944 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | methyl 4-[[4-(4-formylpiperazine-1-carbonyl)pyrimidin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2nccc(C(=O)N3CCN(C=O)CC3)n2)cc1 |
| InChI | InChI=1S/C18H19N5O4/c1-27-17(26)13-2-4-14(5-3-13)20-18-19-7-6-15(21-18)16(25)23-10-8-22(12-24)9-11-23/h2-7,12H,8-11H2,1H3,(H,19,20,21) |
| InChIKey | USKLEUFKLVRJKS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|