C18H19ClN4O3 — CID 109208801
4-[4-(5-chloro-2-methoxyanilino)pyridine-2-carbonyl]piperazine-1-carbaldehyde (PubChem CID 109208801) has the molecular formula C18H19ClN4O3 and a molecular weight of 374.83 g/mol. Its IUPAC name is 4-[4-(5-chloro-2-methoxyanilino)pyridine-2-carbonyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[4-(5-chloro-2-methoxyanilino)pyridine-2-carbonyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 109208801 |
| Molecular Formula | C18H19ClN4O3 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 4-[4-(5-chloro-2-methoxyanilino)pyridine-2-carbonyl]piperazine-1-carbaldehyde |
| SMILES | COc1ccc(Cl)cc1Nc1ccnc(C(=O)N2CCN(C=O)CC2)c1 |
| InChI | InChI=1S/C18H19ClN4O3/c1-26-17-3-2-13(19)10-15(17)21-14-4-5-20-16(11-14)18(25)23-8-6-22(12-24)7-9-23/h2-5,10-12H,6-9H2,1H3,(H,20,21) |
| InChIKey | VWJCHYPBPBKVFV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|