C20H29N3O3 — CID 108961098
N-(4-tert-butylphenyl)-3-(4-formylpiperazin-1-yl)-2,2-dimethyl-3-oxopropanamide (PubChem CID 108961098) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-3-(4-formylpiperazin-1-yl)-2,2-dimethyl-3-oxopropanamide.
| Compound Name | N-(4-tert-butylphenyl)-3-(4-formylpiperazin-1-yl)-2,2-dimethyl-3-oxopropanamide |
|---|---|
| PubChem CID | 108961098 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N-(4-tert-butylphenyl)-3-(4-formylpiperazin-1-yl)-2,2-dimethyl-3-oxopropanamide |
| SMILES | CC(C)(C(=O)Nc1ccc(C(C)(C)C)cc1)C(=O)N1CCN(C=O)CC1 |
| InChI | InChI=1S/C20H29N3O3/c1-19(2,3)15-6-8-16(9-7-15)21-17(25)20(4,5)18(26)23-12-10-22(14-24)11-13-23/h6-9,14H,10-13H2,1-5H3,(H,21,25) |
| InChIKey | GDFWYWRAWJNLCS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|