C22H23NO5 — CID 134946487
ethyl 8-(2-hydroxyethyl)-15-methyl-16-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylate (PubChem CID 134946487) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is ethyl 8-(2-hydroxyethyl)-15-methyl-16-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylate.
| Compound Name | ethyl 8-(2-hydroxyethyl)-15-methyl-16-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylate |
|---|---|
| PubChem CID | 134946487 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | ethyl 8-(2-hydroxyethyl)-15-methyl-16-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylate |
| SMILES | CCOC(=O)C1(C)C2c3ccccc3C(CCO)(c3ccccc32)C1[N+](=O)[O-] |
| InChI | InChI=1S/C22H23NO5/c1-3-28-20(25)21(2)18-14-8-4-6-10-16(14)22(12-13-24,19(21)23(26)27)17-11-7-5-9-15(17)18/h4-11,18-19,24H,3,12-13H2,1-2H3 |
| InChIKey | YUJPTPRKSREKKF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|