C25H23NO3 — CID 134946460
2-(8-methyl-15-nitro-16-phenyl-1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanol (PubChem CID 134946460) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-(8-methyl-15-nitro-16-phenyl-1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanol.
| Compound Name | 2-(8-methyl-15-nitro-16-phenyl-1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanol |
|---|---|
| PubChem CID | 134946460 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-(8-methyl-15-nitro-16-phenyl-1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanol |
| SMILES | CC12c3ccccc3C(CCO)(c3ccccc31)C([N+](=O)[O-])C2c1ccccc1 |
| InChI | InChI=1S/C25H23NO3/c1-24-18-11-5-7-13-20(18)25(15-16-27,21-14-8-6-12-19(21)24)23(26(28)29)22(24)17-9-3-2-4-10-17/h2-14,22-23,27H,15-16H2,1H3 |
| InChIKey | OIRDGXLGYHIFRB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|