C17H17N3O4 — CID 69159814
ethyl (1S)-1-[(3-nitro-2-pyridinyl)amino]-2,3-dihydroindene-1-carboxylate (PubChem CID 69159814) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is ethyl (1S)-1-[(3-nitro-2-pyridinyl)amino]-2,3-dihydroindene-1-carboxylate.
| Compound Name | ethyl (1S)-1-[(3-nitro-2-pyridinyl)amino]-2,3-dihydroindene-1-carboxylate |
|---|---|
| PubChem CID | 69159814 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | ethyl (1S)-1-[(3-nitro-2-pyridinyl)amino]-2,3-dihydroindene-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(Nc2ncccc2[N+](=O)[O-])CCc2ccccc21 |
| InChI | InChI=1S/C17H17N3O4/c1-2-24-16(21)17(10-9-12-6-3-4-7-13(12)17)19-15-14(20(22)23)8-5-11-18-15/h3-8,11H,2,9-10H2,1H3,(H,18,19)/t17-/m0/s1 |
| InChIKey | GHUOAZRXROCRSM-KRWDZBQOSA-N |
| XLogP | 2.81 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|