C25H24N4O8 — CID 160882422
ethyl 2-(4-aminophenyl)-2-oxoacetate;ethyl 2-[4-[(3-nitro-2-pyridinyl)amino]phenyl]-2-oxoacetate (PubChem CID 160882422) has the molecular formula C25H24N4O8 and a molecular weight of 508.49 g/mol. Its IUPAC name is ethyl 2-(4-aminophenyl)-2-oxoacetate;ethyl 2-[4-[(3-nitro-2-pyridinyl)amino]phenyl]-2-oxoacetate.
| Compound Name | ethyl 2-(4-aminophenyl)-2-oxoacetate;ethyl 2-[4-[(3-nitro-2-pyridinyl)amino]phenyl]-2-oxoacetate |
|---|---|
| PubChem CID | 160882422 |
| Molecular Formula | C25H24N4O8 |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | ethyl 2-(4-aminophenyl)-2-oxoacetate;ethyl 2-[4-[(3-nitro-2-pyridinyl)amino]phenyl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1ccc(N)cc1.CCOC(=O)C(=O)c1ccc(Nc2ncccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H13N3O5.C10H11NO3/c1-2-23-15(20)13(19)10-5-7-11(8-6-10)17-14-12(18(21)22)4-3-9-16-14;1-2-14-10(13)9(12)7-3-5-8(11)6-4-7/h3-9H,2H2,1H3,(H,16,17);3-6H,2,11H2,1H3 |
| InChIKey | SNEZRGYTGHZFMZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 180.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|