C21H26N4O6 — CID 25066430
ethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(3-nitro-2-pyridinyl)amino]phenyl]propanoate (PubChem CID 25066430) has the molecular formula C21H26N4O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is ethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(3-nitro-2-pyridinyl)amino]phenyl]propanoate.
| Compound Name | ethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(3-nitro-2-pyridinyl)amino]phenyl]propanoate |
|---|---|
| PubChem CID | 25066430 |
| Molecular Formula | C21H26N4O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | ethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-[(3-nitro-2-pyridinyl)amino]phenyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1cccc(Nc2ncccc2[N+](=O)[O-])c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H26N4O6/c1-5-30-19(26)16(24-20(27)31-21(2,3)4)13-14-8-6-9-15(12-14)23-18-17(25(28)29)10-7-11-22-18/h6-12,16H,5,13H2,1-4H3,(H,22,23)(H,24,27)/t16-/m0/s1 |
| InChIKey | SUIVWJBVFJKHCK-INIZCTEOSA-N |
| XLogP | 3.73 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|