C15H23N3O4 — CID 71565361
tert-butyl (2S)-4-methyl-2-[(3-nitro-2-pyridinyl)amino]pentanoate (PubChem CID 71565361) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is tert-butyl (2S)-4-methyl-2-[(3-nitro-2-pyridinyl)amino]pentanoate.
| Compound Name | tert-butyl (2S)-4-methyl-2-[(3-nitro-2-pyridinyl)amino]pentanoate |
|---|---|
| PubChem CID | 71565361 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | tert-butyl (2S)-4-methyl-2-[(3-nitro-2-pyridinyl)amino]pentanoate |
| SMILES | CC(C)C[C@H](Nc1ncccc1[N+](=O)[O-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23N3O4/c1-10(2)9-11(14(19)22-15(3,4)5)17-13-12(18(20)21)7-6-8-16-13/h6-8,10-11H,9H2,1-5H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | CQWUTOPLCIQWGV-NSHDSACASA-N |
| XLogP | 3.16 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|