C11H14N4O6 — CID 71352519
(2S)-2-[(3,4-dinitro-2-pyridinyl)amino]-4-methylpentanoic acid (PubChem CID 71352519) has the molecular formula C11H14N4O6 and a molecular weight of 298.26 g/mol. Its IUPAC name is (2S)-2-[(3,4-dinitro-2-pyridinyl)amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(3,4-dinitro-2-pyridinyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 71352519 |
| Molecular Formula | C11H14N4O6 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (2S)-2-[(3,4-dinitro-2-pyridinyl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](Nc1nccc([N+](=O)[O-])c1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C11H14N4O6/c1-6(2)5-7(11(16)17)13-10-9(15(20)21)8(14(18)19)3-4-12-10/h3-4,6-7H,5H2,1-2H3,(H,12,13)(H,16,17)/t7-/m0/s1 |
| InChIKey | ITWMKQZZJDEAGO-ZETCQYMHSA-N |
| XLogP | 1.81 |
| TPSA | 148.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|