C29H46N8O11 — CID 159512909
tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl N-[2-[(3-nitro-2-pyridinyl)amino]ethyl]carbamate;N'-(3-nitro-2-pyridinyl)ethane-1,2-diamine (PubChem CID 159512909) has the molecular formula C29H46N8O11 and a molecular weight of 682.73 g/mol. Its IUPAC name is tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl N-[2-[(3-nitro-2-pyridinyl)amino]ethyl]carbamate;N'-(3-nitro-2-pyridinyl)ethane-1,2-diamine.
| Compound Name | tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl N-[2-[(3-nitro-2-pyridinyl)amino]ethyl]carbamate;N'-(3-nitro-2-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 159512909 |
| Molecular Formula | C29H46N8O11 |
| Molecular Weight | 682.73 g/mol |
| Exact Mass | 682.33 |
| IUPAC Name | tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate;tert-butyl N-[2-[(3-nitro-2-pyridinyl)amino]ethyl]carbamate;N'-(3-nitro-2-pyridinyl)ethane-1,2-diamine |
| SMILES | CC(C)(C)OC(=O)NCCNc1ncccc1[N+](=O)[O-].CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.NCCNc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N4O4.C10H18O5.C7H10N4O2/c1-12(2,3)20-11(17)15-8-7-14-10-9(16(18)19)5-4-6-13-10;1-9(2,3)14-7(11)13-8(12)15-10(4,5)6;8-3-5-10-7-6(11(12)13)2-1-4-9-7/h4-6H,7-8H2,1-3H3,(H,13,14)(H,15,17);1-6H3;1-2,4H,3,5,8H2,(H,9,10) |
| InChIKey | MAVCJYLVOZLUQN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 262.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.73 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|