C18H22N2O7 — CID 91200233
diethyl 4-acetyl-5-(2-nitrophenyl)pyrrolidine-2,2-dicarboxylate (PubChem CID 91200233) has the molecular formula C18H22N2O7 and a molecular weight of 378.38 g/mol. Its IUPAC name is diethyl 4-acetyl-5-(2-nitrophenyl)pyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl 4-acetyl-5-(2-nitrophenyl)pyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 91200233 |
| Molecular Formula | C18H22N2O7 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | diethyl 4-acetyl-5-(2-nitrophenyl)pyrrolidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(C(C)=O)C(c2ccccc2[N+](=O)[O-])N1 |
| InChI | InChI=1S/C18H22N2O7/c1-4-26-16(22)18(17(23)27-5-2)10-13(11(3)21)15(19-18)12-8-6-7-9-14(12)20(24)25/h6-9,13,15,19H,4-5,10H2,1-3H3 |
| InChIKey | AYTHBEPZAFHNOE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|