C19H20N2O5 — CID 97038319
ethyl (3S,5R)-5-methyl-3-(2-nitrophenyl)-2-phenyl-1,2-oxazolidine-5-carboxylate (PubChem CID 97038319) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is ethyl (3S,5R)-5-methyl-3-(2-nitrophenyl)-2-phenyl-1,2-oxazolidine-5-carboxylate.
| Compound Name | ethyl (3S,5R)-5-methyl-3-(2-nitrophenyl)-2-phenyl-1,2-oxazolidine-5-carboxylate |
|---|---|
| PubChem CID | 97038319 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | ethyl (3S,5R)-5-methyl-3-(2-nitrophenyl)-2-phenyl-1,2-oxazolidine-5-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)C[C@@H](c2ccccc2[N+](=O)[O-])N(c2ccccc2)O1 |
| InChI | InChI=1S/C19H20N2O5/c1-3-25-18(22)19(2)13-17(15-11-7-8-12-16(15)21(23)24)20(26-19)14-9-5-4-6-10-14/h4-12,17H,3,13H2,1-2H3/t17-,19+/m0/s1 |
| InChIKey | PYIYVAOBJGYRBB-PKOBYXMFSA-N |
| XLogP | 3.80 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|