C13H14N2O4S — CID 174522685
ethyl 4-methyl-2-nitro-5-phenyl-5H-1,3-thiazole-4-carboxylate (PubChem CID 174522685) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is ethyl 4-methyl-2-nitro-5-phenyl-5H-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 4-methyl-2-nitro-5-phenyl-5H-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 174522685 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | ethyl 4-methyl-2-nitro-5-phenyl-5H-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)C1(C)N=C([N+](=O)[O-])SC1c1ccccc1 |
| InChI | InChI=1S/C13H14N2O4S/c1-3-19-11(16)13(2)10(9-7-5-4-6-8-9)20-12(14-13)15(17)18/h4-8,10H,3H2,1-2H3 |
| InChIKey | UWIBRDBXSMRRDO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|