C23H18N4O4S — CID 2816309
ethyl 3-cyano-2-(4-nitrophenyl)-4-phenyl-5-thiophen-2-yl-4H-pyrazole-3-carboxylate (PubChem CID 2816309) has the molecular formula C23H18N4O4S and a molecular weight of 446.49 g/mol. Its IUPAC name is ethyl 3-cyano-2-(4-nitrophenyl)-4-phenyl-5-thiophen-2-yl-4H-pyrazole-3-carboxylate.
| Compound Name | ethyl 3-cyano-2-(4-nitrophenyl)-4-phenyl-5-thiophen-2-yl-4H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 2816309 |
| Molecular Formula | C23H18N4O4S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | ethyl 3-cyano-2-(4-nitrophenyl)-4-phenyl-5-thiophen-2-yl-4H-pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1(C#N)C(c2ccccc2)C(c2cccs2)=NN1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H18N4O4S/c1-2-31-22(28)23(15-24)20(16-7-4-3-5-8-16)21(19-9-6-14-32-19)25-26(23)17-10-12-18(13-11-17)27(29)30/h3-14,20H,2H2,1H3 |
| InChIKey | NQEFZLHIBJRGNT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 108.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|