C24H21N4O4S- — CID 163131061
ethyl (3R,4S)-3-cyano-2-[4-[hydroxy(oxido)amino]phenyl]-4-(4-methylphenyl)-5-thiophen-2-yl-4H-pyrazole-3-carboxylate (PubChem CID 163131061) has the molecular formula C24H21N4O4S- and a molecular weight of 461.52 g/mol. Its IUPAC name is ethyl (3R,4S)-3-cyano-2-[4-[hydroxy(oxido)amino]phenyl]-4-(4-methylphenyl)-5-thiophen-2-yl-4H-pyrazole-3-carboxylate.
| Compound Name | ethyl (3R,4S)-3-cyano-2-[4-[hydroxy(oxido)amino]phenyl]-4-(4-methylphenyl)-5-thiophen-2-yl-4H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 163131061 |
| Molecular Formula | C24H21N4O4S- |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | ethyl (3R,4S)-3-cyano-2-[4-[hydroxy(oxido)amino]phenyl]-4-(4-methylphenyl)-5-thiophen-2-yl-4H-pyrazole-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(C#N)[C@H](c2ccc(C)cc2)C(c2cccs2)=NN1c1ccc(N([O-])O)cc1 |
| InChI | InChI=1S/C24H21N4O4S/c1-3-32-23(29)24(15-25)21(17-8-6-16(2)7-9-17)22(20-5-4-14-33-20)26-27(24)18-10-12-19(13-11-18)28(30)31/h4-14,21,30H,3H2,1-2H3/q-1/t21-,24+/m1/s1 |
| InChIKey | SQXGEXRSSQGQBQ-QPPBQGQZSA-N |
| XLogP | 4.58 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|