C28H19N3O4S — CID 11812999
4-(4-methylphenyl)-1-(4-nitrophenyl)-3-thiophen-2-ylspiro[4H-pyrazole-5,2'-indene]-1',3'-dione (PubChem CID 11812999) has the molecular formula C28H19N3O4S and a molecular weight of 493.54 g/mol. Its IUPAC name is 4-(4-methylphenyl)-1-(4-nitrophenyl)-3-thiophen-2-ylspiro[4H-pyrazole-5,2'-indene]-1',3'-dione.
| Compound Name | 4-(4-methylphenyl)-1-(4-nitrophenyl)-3-thiophen-2-ylspiro[4H-pyrazole-5,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 11812999 |
| Molecular Formula | C28H19N3O4S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 4-(4-methylphenyl)-1-(4-nitrophenyl)-3-thiophen-2-ylspiro[4H-pyrazole-5,2'-indene]-1',3'-dione |
| SMILES | Cc1ccc(C2C(c3cccs3)=NN(c3ccc([N+](=O)[O-])cc3)C23C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C28H19N3O4S/c1-17-8-10-18(11-9-17)24-25(23-7-4-16-36-23)29-30(19-12-14-20(15-13-19)31(34)35)28(24)26(32)21-5-2-3-6-22(21)27(28)33/h2-16,24H,1H3 |
| InChIKey | GJIQTAMRZNACPE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 92.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|