C27H18N4O3S3 — CID 7173693
(5S,7E)-7-benzylidene-4-(4-nitrophenyl)-9-phenyl-2-thiophen-2-yl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-en-8-one (PubChem CID 7173693) has the molecular formula C27H18N4O3S3 and a molecular weight of 542.67 g/mol. Its IUPAC name is (5S,7E)-7-benzylidene-4-(4-nitrophenyl)-9-phenyl-2-thiophen-2-yl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-en-8-one.
| Compound Name | (5S,7E)-7-benzylidene-4-(4-nitrophenyl)-9-phenyl-2-thiophen-2-yl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-en-8-one |
|---|---|
| PubChem CID | 7173693 |
| Molecular Formula | C27H18N4O3S3 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.05 |
| IUPAC Name | (5S,7E)-7-benzylidene-4-(4-nitrophenyl)-9-phenyl-2-thiophen-2-yl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-en-8-one |
| SMILES | O=C1/C(=C\c2ccccc2)S[C@]2(SC(c3cccs3)=NN2c2ccc([N+](=O)[O-])cc2)N1c1ccccc1 |
| InChI | InChI=1S/C27H18N4O3S3/c32-26-24(18-19-8-3-1-4-9-19)36-27(29(26)20-10-5-2-6-11-20)30(21-13-15-22(16-14-21)31(33)34)28-25(37-27)23-12-7-17-35-23/h1-18H/b24-18+/t27-/m0/s1 |
| InChIKey | PSPQSKYDILSWKF-OLIAQGHGSA-N |
| XLogP | 7.00 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|