C25H18ClN3O2S2 — CID 42545250
(5R,7E)-2-acetyl-7-benzylidene-4-(4-chlorophenyl)-9-phenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-en-8-one (PubChem CID 42545250) has the molecular formula C25H18ClN3O2S2 and a molecular weight of 492.03 g/mol. Its IUPAC name is (5R,7E)-2-acetyl-7-benzylidene-4-(4-chlorophenyl)-9-phenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-en-8-one.
| Compound Name | (5R,7E)-2-acetyl-7-benzylidene-4-(4-chlorophenyl)-9-phenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-en-8-one |
|---|---|
| PubChem CID | 42545250 |
| Molecular Formula | C25H18ClN3O2S2 |
| Molecular Weight | 492.03 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | (5R,7E)-2-acetyl-7-benzylidene-4-(4-chlorophenyl)-9-phenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-en-8-one |
| SMILES | CC(=O)C1=NN(c2ccc(Cl)cc2)[C@@]2(S1)S/C(=C/c1ccccc1)C(=O)N2c1ccccc1 |
| InChI | InChI=1S/C25H18ClN3O2S2/c1-17(30)23-27-29(21-14-12-19(26)13-15-21)25(33-23)28(20-10-6-3-7-11-20)24(31)22(32-25)16-18-8-4-2-5-9-18/h2-16H,1H3/b22-16+/t25-/m1/s1 |
| InChIKey | KWXDMXRIRXSBKW-UQTDQPHJSA-N |
| XLogP | 6.23 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.03 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|