C31H23N3O2S2 — CID 2815441
2-benzoyl-7-benzylidene-4-(4-methylphenyl)-9-phenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-en-8-one (PubChem CID 2815441) has the molecular formula C31H23N3O2S2 and a molecular weight of 533.68 g/mol. Its IUPAC name is 2-benzoyl-7-benzylidene-4-(4-methylphenyl)-9-phenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-en-8-one.
| Compound Name | 2-benzoyl-7-benzylidene-4-(4-methylphenyl)-9-phenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-en-8-one |
|---|---|
| PubChem CID | 2815441 |
| Molecular Formula | C31H23N3O2S2 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 2-benzoyl-7-benzylidene-4-(4-methylphenyl)-9-phenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-en-8-one |
| SMILES | Cc1ccc(N2N=C(C(=O)c3ccccc3)SC23SC(=Cc2ccccc2)C(=O)N3c2ccccc2)cc1 |
| InChI | InChI=1S/C31H23N3O2S2/c1-22-17-19-26(20-18-22)34-31(38-29(32-34)28(35)24-13-7-3-8-14-24)33(25-15-9-4-10-16-25)30(36)27(37-31)21-23-11-5-2-6-12-23/h2-21H,1H3 |
| InChIKey | CMARFFHKHSJSHH-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|