C25H19N3O3S2 — CID 6017669
methyl (7Z)-7-benzylidene-8-oxo-4,9-diphenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-ene-2-carboxylate (PubChem CID 6017669) has the molecular formula C25H19N3O3S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is methyl (7Z)-7-benzylidene-8-oxo-4,9-diphenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-ene-2-carboxylate.
| Compound Name | methyl (7Z)-7-benzylidene-8-oxo-4,9-diphenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 6017669 |
| Molecular Formula | C25H19N3O3S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | methyl (7Z)-7-benzylidene-8-oxo-4,9-diphenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-ene-2-carboxylate |
| SMILES | COC(=O)C1=NN(c2ccccc2)C2(S1)S/C(=C\c1ccccc1)C(=O)N2c1ccccc1 |
| InChI | InChI=1S/C25H19N3O3S2/c1-31-24(30)22-26-28(20-15-9-4-10-16-20)25(33-22)27(19-13-7-3-8-14-19)23(29)21(32-25)17-18-11-5-2-6-12-18/h2-17H,1H3/b21-17- |
| InChIKey | VBNVPUXUOUKNKJ-FXBPSFAMSA-N |
| XLogP | 5.16 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|