C31H24N4O2S2 — CID 97292847
(5R,7E)-7-benzylidene-4-(4-methylphenyl)-8-oxo-N,9-diphenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-ene-2-carboxamide (PubChem CID 97292847) has the molecular formula C31H24N4O2S2 and a molecular weight of 548.69 g/mol. Its IUPAC name is (5R,7E)-7-benzylidene-4-(4-methylphenyl)-8-oxo-N,9-diphenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-ene-2-carboxamide.
| Compound Name | (5R,7E)-7-benzylidene-4-(4-methylphenyl)-8-oxo-N,9-diphenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-ene-2-carboxamide |
|---|---|
| PubChem CID | 97292847 |
| Molecular Formula | C31H24N4O2S2 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | (5R,7E)-7-benzylidene-4-(4-methylphenyl)-8-oxo-N,9-diphenyl-1,6-dithia-3,4,9-triazaspiro[4.4]non-2-ene-2-carboxamide |
| SMILES | Cc1ccc(N2N=C(C(=O)Nc3ccccc3)S[C@@]23S/C(=C/c2ccccc2)C(=O)N3c2ccccc2)cc1 |
| InChI | InChI=1S/C31H24N4O2S2/c1-22-17-19-26(20-18-22)35-31(39-29(33-35)28(36)32-24-13-7-3-8-14-24)34(25-15-9-4-10-16-25)30(37)27(38-31)21-23-11-5-2-6-12-23/h2-21H,1H3,(H,32,36)/b27-21+/t31-/m1/s1 |
| InChIKey | UBDGOAYNVHGOJR-JLQYGJBJSA-N |
| XLogP | 6.93 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|