C38H23N3O8 — CID 3096503
3',5'-Bis(4-nitrophenyl)-1'-phenyldispiro[indene-2,2'-pyrrolidine-4',2''-indene]-1,1'',3,3''-tetrone (PubChem CID 3096503) has the molecular formula C38H23N3O8 and a molecular weight of 649.62 g/mol.
| Compound Name | 3',5'-Bis(4-nitrophenyl)-1'-phenyldispiro[indene-2,2'-pyrrolidine-4',2''-indene]-1,1'',3,3''-tetrone |
|---|---|
| PubChem CID | 3096503 |
| Molecular Formula | C38H23N3O8 |
| Molecular Weight | 649.62 g/mol |
| Exact Mass | 649.15 |
| IUPAC Name | — |
| SMILES | O=C1c2ccccc2C(=O)C12C(c1ccc([N+](=O)[O-])cc1)N(c1ccccc1)C1(C(=O)c3ccccc3C1=O)C2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C38H23N3O8/c42-33-27-10-4-5-11-28(27)34(43)37(33)31(22-14-18-25(19-15-22)40(46)47)38(35(44)29-12-6-7-13-30(29)36(38)45)39(24-8-2-1-3-9-24)32(37)23-16-20-26(21-17-23)41(48)49/h1-21,31-32H |
| InChIKey | VQQQAEBHUOQRJB-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.62 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|