C32H18BrNO7 — CID 3098555
2'-(4-bromophenyl)-4'-(4-nitrophenyl)-dispiro[bis[1H-indene-1,3(2H)-dione]-2,3':2'',5'-tetrahydrofuran] (PubChem CID 3098555) has the molecular formula C32H18BrNO7 and a molecular weight of 608.40 g/mol.
| Compound Name | 2'-(4-bromophenyl)-4'-(4-nitrophenyl)-dispiro[bis[1H-indene-1,3(2H)-dione]-2,3':2'',5'-tetrahydrofuran] |
|---|---|
| PubChem CID | 3098555 |
| Molecular Formula | C32H18BrNO7 |
| Molecular Weight | 608.40 g/mol |
| Exact Mass | 607.03 |
| IUPAC Name | — |
| SMILES | O=C1c2ccccc2C(=O)C12OC(c1ccc(Br)cc1)C1(C(=O)c3ccccc3C1=O)C2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H18BrNO7/c33-19-13-9-18(10-14-19)30-31(26(35)21-5-1-2-6-22(21)27(31)36)25(17-11-15-20(16-12-17)34(39)40)32(41-30)28(37)23-7-3-4-8-24(23)29(32)38/h1-16,25,30H |
| InChIKey | FCJROCZUCQIXKW-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.40 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|