C30H25N3O6 — CID 91897435
(2R,3Z)-3-[hydroxy-[(2-methylpropan-2-yl)oxy]methylidene]-2-(4-nitrophenyl)spiro[2,10b-dihydropyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione (PubChem CID 91897435) has the molecular formula C30H25N3O6 and a molecular weight of 523.55 g/mol. Its IUPAC name is (2R,3Z)-3-[hydroxy-[(2-methylpropan-2-yl)oxy]methylidene]-2-(4-nitrophenyl)spiro[2,10b-dihydropyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione.
| Compound Name | (2R,3Z)-3-[hydroxy-[(2-methylpropan-2-yl)oxy]methylidene]-2-(4-nitrophenyl)spiro[2,10b-dihydropyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 91897435 |
| Molecular Formula | C30H25N3O6 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | (2R,3Z)-3-[hydroxy-[(2-methylpropan-2-yl)oxy]methylidene]-2-(4-nitrophenyl)spiro[2,10b-dihydropyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione |
| SMILES | CC(C)(C)O/C(O)=C1/[C@H](c2ccc([N+](=O)[O-])cc2)C2(C(=O)c3ccccc3C2=O)C2c3ccccc3C=NN12 |
| InChI | InChI=1S/C30H25N3O6/c1-29(2,3)39-28(36)24-23(17-12-14-19(15-13-17)33(37)38)30(26(34)21-10-6-7-11-22(21)27(30)35)25-20-9-5-4-8-18(20)16-31-32(24)25/h4-16,23,25,36H,1-3H3/b28-24-/t23-,25?/m0/s1 |
| InChIKey | XKXJVJZAFNJDAV-TTWCKONFSA-N |
| XLogP | 5.69 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|