C32H20BrClN2O3 — CID 133269322
(2S,3S)-2-(4-bromophenyl)-3-(4-chlorobenzoyl)spiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione (PubChem CID 133269322) has the molecular formula C32H20BrClN2O3 and a molecular weight of 595.88 g/mol. Its IUPAC name is (2S,3S)-2-(4-bromophenyl)-3-(4-chlorobenzoyl)spiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione.
| Compound Name | (2S,3S)-2-(4-bromophenyl)-3-(4-chlorobenzoyl)spiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 133269322 |
| Molecular Formula | C32H20BrClN2O3 |
| Molecular Weight | 595.88 g/mol |
| Exact Mass | 594.03 |
| IUPAC Name | (2S,3S)-2-(4-bromophenyl)-3-(4-chlorobenzoyl)spiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione |
| SMILES | O=C(c1ccc(Cl)cc1)[C@@H]1[C@@H](c2ccc(Br)cc2)C2(C(=O)c3ccccc3C2=O)C2c3ccccc3C=NN21 |
| InChI | InChI=1S/C32H20BrClN2O3/c33-21-13-9-18(10-14-21)26-27(28(37)19-11-15-22(34)16-12-19)36-29(23-6-2-1-5-20(23)17-35-36)32(26)30(38)24-7-3-4-8-25(24)31(32)39/h1-17,26-27,29H/t26-,27+,29?/m1/s1 |
| InChIKey | YIEICXSUEIMIKC-QZIBZCQVSA-N |
| XLogP | 6.91 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.88 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|