C32H21N3O5 — CID 124779336
(2R,3S,10bS)-3-benzoyl-2-(3-nitrophenyl)spiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione (PubChem CID 124779336) has the molecular formula C32H21N3O5 and a molecular weight of 527.54 g/mol. Its IUPAC name is (2R,3S,10bS)-3-benzoyl-2-(3-nitrophenyl)spiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione.
| Compound Name | (2R,3S,10bS)-3-benzoyl-2-(3-nitrophenyl)spiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 124779336 |
| Molecular Formula | C32H21N3O5 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | (2R,3S,10bS)-3-benzoyl-2-(3-nitrophenyl)spiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@H](c2cccc([N+](=O)[O-])c2)C2(C(=O)c3ccccc3C2=O)[C@@H]2c3ccccc3C=NN12 |
| InChI | InChI=1S/C32H21N3O5/c36-28(19-9-2-1-3-10-19)27-26(20-12-8-13-22(17-20)35(39)40)32(30(37)24-15-6-7-16-25(24)31(32)38)29-23-14-5-4-11-21(23)18-33-34(27)29/h1-18,26-27,29H/t26-,27-,29-/m0/s1 |
| InChIKey | IRNMWEAMGGIWEC-YCVJPRETSA-N |
| XLogP | 5.40 |
| TPSA | 109.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|