C32H21ClN4O5 — CID 100864212
(2S,3S,10bS)-N-(4-chlorophenyl)-2-(4-nitrophenyl)-1',3'-dioxospiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-3-carboxamide (PubChem CID 100864212) has the molecular formula C32H21ClN4O5 and a molecular weight of 577.00 g/mol. Its IUPAC name is (2S,3S,10bS)-N-(4-chlorophenyl)-2-(4-nitrophenyl)-1',3'-dioxospiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-3-carboxamide.
| Compound Name | (2S,3S,10bS)-N-(4-chlorophenyl)-2-(4-nitrophenyl)-1',3'-dioxospiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-3-carboxamide |
|---|---|
| PubChem CID | 100864212 |
| Molecular Formula | C32H21ClN4O5 |
| Molecular Weight | 577.00 g/mol |
| Exact Mass | 576.12 |
| IUPAC Name | (2S,3S,10bS)-N-(4-chlorophenyl)-2-(4-nitrophenyl)-1',3'-dioxospiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)[C@@H]1[C@@H](c2ccc([N+](=O)[O-])cc2)C2(C(=O)c3ccccc3C2=O)[C@@H]2c3ccccc3C=NN12 |
| InChI | InChI=1S/C32H21ClN4O5/c33-20-11-13-21(14-12-20)35-31(40)27-26(18-9-15-22(16-10-18)37(41)42)32(29(38)24-7-3-4-8-25(24)30(32)39)28-23-6-2-1-5-19(23)17-34-36(27)28/h1-17,26-28H,(H,35,40)/t26-,27+,28+/m1/s1 |
| InChIKey | SZNRUMYDPKRDJJ-PKTNWEFCSA-N |
| XLogP | 5.81 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.00 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|