C30H19ClN2O4 — CID 40927217
(2R,3R,10bS)-3-(4-chlorobenzoyl)-2-(furan-2-yl)spiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione (PubChem CID 40927217) has the molecular formula C30H19ClN2O4 and a molecular weight of 506.95 g/mol. Its IUPAC name is (2R,3R,10bS)-3-(4-chlorobenzoyl)-2-(furan-2-yl)spiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione.
| Compound Name | (2R,3R,10bS)-3-(4-chlorobenzoyl)-2-(furan-2-yl)spiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 40927217 |
| Molecular Formula | C30H19ClN2O4 |
| Molecular Weight | 506.95 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | (2R,3R,10bS)-3-(4-chlorobenzoyl)-2-(furan-2-yl)spiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione |
| SMILES | O=C(c1ccc(Cl)cc1)[C@H]1[C@H](c2ccco2)C2(C(=O)c3ccccc3C2=O)[C@@H]2c3ccccc3C=NN21 |
| InChI | InChI=1S/C30H19ClN2O4/c31-19-13-11-17(12-14-19)26(34)25-24(23-10-5-15-37-23)30(28(35)21-8-3-4-9-22(21)29(30)36)27-20-7-2-1-6-18(20)16-32-33(25)27/h1-16,24-25,27H/t24-,25+,27-/m0/s1 |
| InChIKey | IYNZKUMEHZJJBH-WEWMWRJBSA-N |
| XLogP | 5.74 |
| TPSA | 79.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.95 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|