C32H30N2O5 — CID 6580355
(2R,3R,10bS)-2-(2,4-dimethoxyphenyl)-3-(2,2-dimethylpropanoyl)spiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione (PubChem CID 6580355) has the molecular formula C32H30N2O5 and a molecular weight of 522.60 g/mol. Its IUPAC name is (2R,3R,10bS)-2-(2,4-dimethoxyphenyl)-3-(2,2-dimethylpropanoyl)spiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione.
| Compound Name | (2R,3R,10bS)-2-(2,4-dimethoxyphenyl)-3-(2,2-dimethylpropanoyl)spiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 6580355 |
| Molecular Formula | C32H30N2O5 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | (2R,3R,10bS)-2-(2,4-dimethoxyphenyl)-3-(2,2-dimethylpropanoyl)spiro[3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine-1,2'-indene]-1',3'-dione |
| SMILES | COc1ccc([C@H]2[C@H](C(=O)C(C)(C)C)N3N=Cc4ccccc4[C@H]3C23C(=O)c2ccccc2C3=O)c(OC)c1 |
| InChI | InChI=1S/C32H30N2O5/c1-31(2,3)30(37)26-25(23-15-14-19(38-4)16-24(23)39-5)32(28(35)21-12-8-9-13-22(21)29(32)36)27-20-11-7-6-10-18(20)17-33-34(26)27/h6-17,25-27H,1-5H3/t25-,26+,27-/m0/s1 |
| InChIKey | FPVOSZGNVGNVLR-VJGNERBWSA-N |
| XLogP | 5.24 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|