C30H26N2O6 — CID 40818225
(2'R,3'S,10'bR)-3'-(4-methoxybenzoyl)-2,2-dimethyl-2'-phenylspiro[1,3-dioxane-5,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine]-4,6-dione (PubChem CID 40818225) has the molecular formula C30H26N2O6 and a molecular weight of 510.55 g/mol. Its IUPAC name is (2'R,3'S,10'bR)-3'-(4-methoxybenzoyl)-2,2-dimethyl-2'-phenylspiro[1,3-dioxane-5,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine]-4,6-dione.
| Compound Name | (2'R,3'S,10'bR)-3'-(4-methoxybenzoyl)-2,2-dimethyl-2'-phenylspiro[1,3-dioxane-5,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine]-4,6-dione |
|---|---|
| PubChem CID | 40818225 |
| Molecular Formula | C30H26N2O6 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | (2'R,3'S,10'bR)-3'-(4-methoxybenzoyl)-2,2-dimethyl-2'-phenylspiro[1,3-dioxane-5,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine]-4,6-dione |
| SMILES | COc1ccc(C(=O)[C@@H]2[C@H](c3ccccc3)C3(C(=O)OC(C)(C)OC3=O)[C@H]3c4ccccc4C=NN23)cc1 |
| InChI | InChI=1S/C30H26N2O6/c1-29(2)37-27(34)30(28(35)38-29)23(18-9-5-4-6-10-18)24(25(33)19-13-15-21(36-3)16-14-19)32-26(30)22-12-8-7-11-20(22)17-31-32/h4-17,23-24,26H,1-3H3/t23-,24-,26+/m0/s1 |
| InChIKey | OQPIGDMJUDRWFB-KYPHJKQUSA-N |
| XLogP | 4.26 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|