C34H32N2O7 — CID 98376937
CID 98376937 (PubChem CID 98376937) has the molecular formula C34H32N2O7 and a molecular weight of 580.64 g/mol.
| Compound Name | CID 98376937 |
|---|---|
| PubChem CID | 98376937 |
| Molecular Formula | C34H32N2O7 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | — |
| SMILES | COc1ccc(C(=O)[C@H]2[C@@H](c3ccc(OC)cc3)C3(C(=O)OC4(CCCCC4)OC3=O)[C@H]3c4ccccc4C=NN23)cc1 |
| InChI | InChI=1S/C34H32N2O7/c1-40-24-14-10-21(11-15-24)27-28(29(37)22-12-16-25(41-2)17-13-22)36-30(26-9-5-4-8-23(26)20-35-36)34(27)31(38)42-33(43-32(34)39)18-6-3-7-19-33/h4-5,8-17,20,27-28,30H,3,6-7,18-19H2,1-2H3/t27-,28-,30-/m1/s1 |
| InChIKey | WHUKKPSUFZCUEL-MUPNOLHXSA-N |
| XLogP | 5.19 |
| TPSA | 103.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|