C32H36N2O8 — CID 98455040
CID 98455040 (PubChem CID 98455040) has the molecular formula C32H36N2O8 and a molecular weight of 576.65 g/mol.
| Compound Name | CID 98455040 |
|---|---|
| PubChem CID | 98455040 |
| Molecular Formula | C32H36N2O8 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | — |
| SMILES | COc1ccc([C@@H]2[C@@H](C(=O)OC(C)(C)C)N3N=Cc4ccccc4[C@@H]3C23C(=O)OC2(CCCCC2)OC3=O)cc1OC |
| InChI | InChI=1S/C32H36N2O8/c1-30(2,3)40-27(35)25-24(19-13-14-22(38-4)23(17-19)39-5)32(26-21-12-8-7-11-20(21)18-33-34(25)26)28(36)41-31(42-29(32)37)15-9-6-10-16-31/h7-8,11-14,17-18,24-26H,6,9-10,15-16H2,1-5H3/t24-,25+,26-/m1/s1 |
| InChIKey | VTNNDIVEQRISJU-UODIDJSMSA-N |
| XLogP | 4.65 |
| TPSA | 112.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|