C30H32N2O8 — CID 100821039
CID 100821039 (PubChem CID 100821039) has the molecular formula C30H32N2O8 and a molecular weight of 548.59 g/mol.
| Compound Name | CID 100821039 |
|---|---|
| PubChem CID | 100821039 |
| Molecular Formula | C30H32N2O8 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | — |
| SMILES | CCOC(=O)[C@@H]1[C@H](c2ccc(OC)c(OC)c2)C2(C(=O)OC3(CCCCC3)OC2=O)[C@@H]2c3ccccc3C=NN12 |
| InChI | InChI=1S/C30H32N2O8/c1-4-38-26(33)24-23(18-12-13-21(36-2)22(16-18)37-3)30(25-20-11-7-6-10-19(20)17-31-32(24)25)27(34)39-29(40-28(30)35)14-8-5-9-15-29/h6-7,10-13,16-17,23-25H,4-5,8-9,14-15H2,1-3H3/t23-,24-,25-/m0/s1 |
| InChIKey | GCOAZBKRJLGGAY-SDHOMARFSA-N |
| XLogP | 3.87 |
| TPSA | 112.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|