C30H32N2O7 — CID 98168550
CID 98168550 (PubChem CID 98168550) has the molecular formula C30H32N2O7 and a molecular weight of 532.59 g/mol.
| Compound Name | CID 98168550 |
|---|---|
| PubChem CID | 98168550 |
| Molecular Formula | C30H32N2O7 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | — |
| SMILES | COc1ccc([C@H]2[C@H](C(=O)OC(C)(C)C)N3N=Cc4ccccc4[C@@H]3C23C(=O)OC2(CCCC2)OC3=O)cc1 |
| InChI | InChI=1S/C30H32N2O7/c1-28(2,3)37-25(33)23-22(18-11-13-20(36-4)14-12-18)30(24-21-10-6-5-9-19(21)17-31-32(23)24)26(34)38-29(39-27(30)35)15-7-8-16-29/h5-6,9-14,17,22-24H,7-8,15-16H2,1-4H3/t22-,23+,24+/m0/s1 |
| InChIKey | GSAQJZFDXUTOOQ-RBZQAINGSA-N |
| XLogP | 4.25 |
| TPSA | 103.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|