C31H29N3O4 — CID 26891645
(2'R,3'R,4S,10'bR)-3'-(2,2-dimethylpropanoyl)-2'-(4-methoxyphenyl)-2-phenylspiro[1,3-oxazole-4,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine]-5-one (PubChem CID 26891645) has the molecular formula C31H29N3O4 and a molecular weight of 507.59 g/mol. Its IUPAC name is (2'R,3'R,4S,10'bR)-3'-(2,2-dimethylpropanoyl)-2'-(4-methoxyphenyl)-2-phenylspiro[1,3-oxazole-4,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine]-5-one.
| Compound Name | (2'R,3'R,4S,10'bR)-3'-(2,2-dimethylpropanoyl)-2'-(4-methoxyphenyl)-2-phenylspiro[1,3-oxazole-4,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine]-5-one |
|---|---|
| PubChem CID | 26891645 |
| Molecular Formula | C31H29N3O4 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | (2'R,3'R,4S,10'bR)-3'-(2,2-dimethylpropanoyl)-2'-(4-methoxyphenyl)-2-phenylspiro[1,3-oxazole-4,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine]-5-one |
| SMILES | COc1ccc([C@@H]2[C@H](C(=O)C(C)(C)C)N3N=Cc4ccccc4[C@@H]3[C@@]23N=C(c2ccccc2)OC3=O)cc1 |
| InChI | InChI=1S/C31H29N3O4/c1-30(2,3)27(35)25-24(19-14-16-22(37-4)17-15-19)31(26-23-13-9-8-12-21(23)18-32-34(25)26)29(36)38-28(33-31)20-10-6-5-7-11-20/h5-18,24-26H,1-4H3/t24-,25-,26-,31+/m1/s1 |
| InChIKey | PMGLUWPDZIVUOU-KUXNCQQFSA-N |
| XLogP | 4.91 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |