C31H28N4O6 — CID 98467460
ethyl (2'R,3'S,5R,10'bR)-1-benzyl-2'-(4-methoxyphenyl)-2,4,6-trioxospiro[1,3-diazinane-5,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine]-3'-carboxylate (PubChem CID 98467460) has the molecular formula C31H28N4O6 and a molecular weight of 552.59 g/mol. Its IUPAC name is ethyl (2'R,3'S,5R,10'bR)-1-benzyl-2'-(4-methoxyphenyl)-2,4,6-trioxospiro[1,3-diazinane-5,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine]-3'-carboxylate.
| Compound Name | ethyl (2'R,3'S,5R,10'bR)-1-benzyl-2'-(4-methoxyphenyl)-2,4,6-trioxospiro[1,3-diazinane-5,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine]-3'-carboxylate |
|---|---|
| PubChem CID | 98467460 |
| Molecular Formula | C31H28N4O6 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | ethyl (2'R,3'S,5R,10'bR)-1-benzyl-2'-(4-methoxyphenyl)-2,4,6-trioxospiro[1,3-diazinane-5,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]phthalazine]-3'-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](c2ccc(OC)cc2)[C@]2(C(=O)NC(=O)N(Cc3ccccc3)C2=O)[C@H]2c3ccccc3C=NN12 |
| InChI | InChI=1S/C31H28N4O6/c1-3-41-27(36)25-24(20-13-15-22(40-2)16-14-20)31(26-23-12-8-7-11-21(23)17-32-35(25)26)28(37)33-30(39)34(29(31)38)18-19-9-5-4-6-10-19/h4-17,24-26H,3,18H2,1-2H3,(H,33,37,39)/t24-,25-,26+,31+/m0/s1 |
| InChIKey | ZOEQKGZZYIVJKO-PZTYDPALSA-N |
| XLogP | 3.38 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|