C31H21NO4 — CID 40979503
(1R,2R,3aR)-1-benzoyl-2-(furan-2-yl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 40979503) has the molecular formula C31H21NO4 and a molecular weight of 471.51 g/mol. Its IUPAC name is (1R,2R,3aR)-1-benzoyl-2-(furan-2-yl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | (1R,2R,3aR)-1-benzoyl-2-(furan-2-yl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 40979503 |
| Molecular Formula | C31H21NO4 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | (1R,2R,3aR)-1-benzoyl-2-(furan-2-yl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | O=C(c1ccccc1)[C@H]1[C@H](c2ccco2)C2(C(=O)c3ccccc3C2=O)[C@H]2C=Cc3ccccc3N12 |
| InChI | InChI=1S/C31H21NO4/c33-28(20-10-2-1-3-11-20)27-26(24-15-8-18-36-24)31(29(34)21-12-5-6-13-22(21)30(31)35)25-17-16-19-9-4-7-14-23(19)32(25)27/h1-18,25-27H/t25-,26+,27-/m1/s1 |
| InChIKey | KAEZJONTHIKCKQ-KWXIBIRDSA-N |
| XLogP | 5.60 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|