C34H22N2O4 — CID 98165189
(8aS,10R,11R)-11-benzoyl-10-(furan-2-yl)spiro[10,11-dihydro-8aH-pyrrolo[1,2-a][1,10]phenanthroline-9,2'-indene]-1',3'-dione (PubChem CID 98165189) has the molecular formula C34H22N2O4 and a molecular weight of 522.56 g/mol. Its IUPAC name is (8aS,10R,11R)-11-benzoyl-10-(furan-2-yl)spiro[10,11-dihydro-8aH-pyrrolo[1,2-a][1,10]phenanthroline-9,2'-indene]-1',3'-dione.
| Compound Name | (8aS,10R,11R)-11-benzoyl-10-(furan-2-yl)spiro[10,11-dihydro-8aH-pyrrolo[1,2-a][1,10]phenanthroline-9,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 98165189 |
| Molecular Formula | C34H22N2O4 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | (8aS,10R,11R)-11-benzoyl-10-(furan-2-yl)spiro[10,11-dihydro-8aH-pyrrolo[1,2-a][1,10]phenanthroline-9,2'-indene]-1',3'-dione |
| SMILES | O=C(c1ccccc1)[C@H]1[C@H](c2ccco2)C2(C(=O)c3ccccc3C2=O)[C@@H]2C=Cc3ccc4cccnc4c3N21 |
| InChI | InChI=1S/C34H22N2O4/c37-31(22-8-2-1-3-9-22)30-27(25-13-7-19-40-25)34(32(38)23-11-4-5-12-24(23)33(34)39)26-17-16-21-15-14-20-10-6-18-35-28(20)29(21)36(26)30/h1-19,26-27,30H/t26-,27-,30+/m0/s1 |
| InChIKey | HBMLFLIJRSOKKO-FEVNIDIWSA-N |
| XLogP | 6.14 |
| TPSA | 80.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|