C35H24FNO5 — CID 127254400
[(1R,2R)-1-benzoyl-2-(4-fluorophenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-9-yl] acetate (PubChem CID 127254400) has the molecular formula C35H24FNO5 and a molecular weight of 557.58 g/mol. Its IUPAC name is [(1R,2R)-1-benzoyl-2-(4-fluorophenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-9-yl] acetate.
| Compound Name | [(1R,2R)-1-benzoyl-2-(4-fluorophenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-9-yl] acetate |
|---|---|
| PubChem CID | 127254400 |
| Molecular Formula | C35H24FNO5 |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | [(1R,2R)-1-benzoyl-2-(4-fluorophenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-9-yl] acetate |
| SMILES | CC(=O)Oc1cccc2c1N1C(C=C2)C2(C(=O)c3ccccc3C2=O)[C@@H](c2ccc(F)cc2)[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C35H24FNO5/c1-20(38)42-27-13-7-10-22-16-19-28-35(33(40)25-11-5-6-12-26(25)34(35)41)29(21-14-17-24(36)18-15-21)31(37(28)30(22)27)32(39)23-8-3-2-4-9-23/h2-19,28-29,31H,1H3/t28?,29-,31+/m0/s1 |
| InChIKey | JOQOPTGQLOFDFJ-CBOMQKSFSA-N |
| XLogP | 6.07 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|