C33H29NO8 — CID 98379396
[(1S,2R,3aR)-1-acetyl-1',3'-dioxo-2-(3,4,5-trimethoxyphenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-9-yl] acetate (PubChem CID 98379396) has the molecular formula C33H29NO8 and a molecular weight of 567.59 g/mol. Its IUPAC name is [(1S,2R,3aR)-1-acetyl-1',3'-dioxo-2-(3,4,5-trimethoxyphenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-9-yl] acetate.
| Compound Name | [(1S,2R,3aR)-1-acetyl-1',3'-dioxo-2-(3,4,5-trimethoxyphenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-9-yl] acetate |
|---|---|
| PubChem CID | 98379396 |
| Molecular Formula | C33H29NO8 |
| Molecular Weight | 567.59 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | [(1S,2R,3aR)-1-acetyl-1',3'-dioxo-2-(3,4,5-trimethoxyphenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-9-yl] acetate |
| SMILES | COc1cc([C@H]2[C@@H](C(C)=O)N3c4c(cccc4OC(C)=O)C=C[C@@H]3C23C(=O)c2ccccc2C3=O)cc(OC)c1OC |
| InChI | InChI=1S/C33H29NO8/c1-17(35)28-27(20-15-24(39-3)30(41-5)25(16-20)40-4)33(31(37)21-10-6-7-11-22(21)32(33)38)26-14-13-19-9-8-12-23(42-18(2)36)29(19)34(26)28/h6-16,26-28H,1-5H3/t26-,27+,28-/m1/s1 |
| InChIKey | FDWXBXCYVDUYBC-OZNIXHKMSA-N |
| XLogP | 4.66 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|