C35H25NO5 — CID 95371387
[(1R,2R,3aS)-1-benzoyl-1',3'-dioxo-2-phenylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-9-yl] acetate (PubChem CID 95371387) has the molecular formula C35H25NO5 and a molecular weight of 539.59 g/mol. Its IUPAC name is [(1R,2R,3aS)-1-benzoyl-1',3'-dioxo-2-phenylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-9-yl] acetate.
| Compound Name | [(1R,2R,3aS)-1-benzoyl-1',3'-dioxo-2-phenylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-9-yl] acetate |
|---|---|
| PubChem CID | 95371387 |
| Molecular Formula | C35H25NO5 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | [(1R,2R,3aS)-1-benzoyl-1',3'-dioxo-2-phenylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-9-yl] acetate |
| SMILES | CC(=O)Oc1cccc2c1N1[C@@H](C=C2)C2(C(=O)c3ccccc3C2=O)[C@@H](c2ccccc2)[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C35H25NO5/c1-21(37)41-27-18-10-15-23-19-20-28-35(33(39)25-16-8-9-17-26(25)34(35)40)29(22-11-4-2-5-12-22)31(36(28)30(23)27)32(38)24-13-6-3-7-14-24/h2-20,28-29,31H,1H3/t28-,29-,31+/m0/s1 |
| InChIKey | YXUDLUCABYSHGV-GSBZAIBZSA-N |
| XLogP | 5.93 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|