C34H24N2O5 — CID 98222289
[4-[(1S,2R,3aR)-1',3'-dioxo-2-pyridin-3-ylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carbonyl]phenyl] acetate (PubChem CID 98222289) has the molecular formula C34H24N2O5 and a molecular weight of 540.58 g/mol. Its IUPAC name is [4-[(1S,2R,3aR)-1',3'-dioxo-2-pyridin-3-ylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carbonyl]phenyl] acetate.
| Compound Name | [4-[(1S,2R,3aR)-1',3'-dioxo-2-pyridin-3-ylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 98222289 |
| Molecular Formula | C34H24N2O5 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | [4-[(1S,2R,3aR)-1',3'-dioxo-2-pyridin-3-ylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)[C@@H]2[C@H](c3cccnc3)C3(C(=O)c4ccccc4C3=O)[C@H]3C=Cc4ccccc4N23)cc1 |
| InChI | InChI=1S/C34H24N2O5/c1-20(37)41-24-15-12-22(13-16-24)31(38)30-29(23-8-6-18-35-19-23)34(32(39)25-9-3-4-10-26(25)33(34)40)28-17-14-21-7-2-5-11-27(21)36(28)30/h2-19,28-30H,1H3/t28-,29+,30+/m1/s1 |
| InChIKey | GIWHFOAGGSDEJP-NGDRWEMDSA-N |
| XLogP | 5.32 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|