C37H29NO7 — CID 98382638
[4-[(1R,2S,3aR)-2-(2,4-dimethoxyphenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carbonyl]phenyl] acetate (PubChem CID 98382638) has the molecular formula C37H29NO7 and a molecular weight of 599.64 g/mol. Its IUPAC name is [4-[(1R,2S,3aR)-2-(2,4-dimethoxyphenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carbonyl]phenyl] acetate.
| Compound Name | [4-[(1R,2S,3aR)-2-(2,4-dimethoxyphenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 98382638 |
| Molecular Formula | C37H29NO7 |
| Molecular Weight | 599.64 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | [4-[(1R,2S,3aR)-2-(2,4-dimethoxyphenyl)-1',3'-dioxospiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carbonyl]phenyl] acetate |
| SMILES | COc1ccc([C@@H]2[C@H](C(=O)c3ccc(OC(C)=O)cc3)N3c4ccccc4C=C[C@@H]3C23C(=O)c2ccccc2C3=O)c(OC)c1 |
| InChI | InChI=1S/C37H29NO7/c1-21(39)45-24-15-12-23(13-16-24)34(40)33-32(28-18-17-25(43-2)20-30(28)44-3)37(35(41)26-9-5-6-10-27(26)36(37)42)31-19-14-22-8-4-7-11-29(22)38(31)33/h4-20,31-33H,1-3H3/t31-,32-,33-/m1/s1 |
| InChIKey | OQSQTQWZVGEJLS-WRVRXEDSSA-N |
| XLogP | 5.95 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.64 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|