C39H35NO5 — CID 4918655
2-(2,4-dimethoxyphenyl)-1-[4-(2-methylpropyl)benzoyl]spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 4918655) has the molecular formula C39H35NO5 and a molecular weight of 597.71 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-1-[4-(2-methylpropyl)benzoyl]spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | 2-(2,4-dimethoxyphenyl)-1-[4-(2-methylpropyl)benzoyl]spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 4918655 |
| Molecular Formula | C39H35NO5 |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-1-[4-(2-methylpropyl)benzoyl]spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | COc1ccc(C2C(C(=O)c3ccc(CC(C)C)cc3)N3c4ccccc4C=CC3C23C(=O)c2ccccc2C3=O)c(OC)c1 |
| InChI | InChI=1S/C39H35NO5/c1-23(2)21-24-13-15-26(16-14-24)36(41)35-34(30-19-18-27(44-3)22-32(30)45-4)39(37(42)28-10-6-7-11-29(28)38(39)43)33-20-17-25-9-5-8-12-31(25)40(33)35/h5-20,22-23,33-35H,21H2,1-4H3 |
| InChIKey | FEAKJRLNMOIUML-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|