C36H29NO6 — CID 100846410
(1S,2R,3aS)-2-(2,3-dimethoxyphenyl)-1-(4-methoxybenzoyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 100846410) has the molecular formula C36H29NO6 and a molecular weight of 571.63 g/mol. Its IUPAC name is (1S,2R,3aS)-2-(2,3-dimethoxyphenyl)-1-(4-methoxybenzoyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | (1S,2R,3aS)-2-(2,3-dimethoxyphenyl)-1-(4-methoxybenzoyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 100846410 |
| Molecular Formula | C36H29NO6 |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | (1S,2R,3aS)-2-(2,3-dimethoxyphenyl)-1-(4-methoxybenzoyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | COc1ccc(C(=O)[C@@H]2[C@H](c3cccc(OC)c3OC)C3(C(=O)c4ccccc4C3=O)[C@@H]3C=Cc4ccccc4N23)cc1 |
| InChI | InChI=1S/C36H29NO6/c1-41-23-18-15-22(16-19-23)32(38)31-30(26-12-8-14-28(42-2)33(26)43-3)36(34(39)24-10-5-6-11-25(24)35(36)40)29-20-17-21-9-4-7-13-27(21)37(29)31/h4-20,29-31H,1-3H3/t29-,30-,31-/m0/s1 |
| InChIKey | ANTYNPVWLIJLPM-CHQNGUEUSA-N |
| XLogP | 6.03 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|