C35H26N2O7 — CID 46924659
(1R,2R)-2-(2,3-dimethoxyphenyl)-1-(4-nitrobenzoyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 46924659) has the molecular formula C35H26N2O7 and a molecular weight of 586.60 g/mol. Its IUPAC name is (1R,2R)-2-(2,3-dimethoxyphenyl)-1-(4-nitrobenzoyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | (1R,2R)-2-(2,3-dimethoxyphenyl)-1-(4-nitrobenzoyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 46924659 |
| Molecular Formula | C35H26N2O7 |
| Molecular Weight | 586.60 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | (1R,2R)-2-(2,3-dimethoxyphenyl)-1-(4-nitrobenzoyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | COc1cccc([C@H]2[C@H](C(=O)c3ccc([N+](=O)[O-])cc3)N3c4ccccc4C=CC3C23C(=O)c2ccccc2C3=O)c1OC |
| InChI | InChI=1S/C35H26N2O7/c1-43-27-13-7-11-25(32(27)44-2)29-30(31(38)21-14-17-22(18-15-21)37(41)42)36-26-12-6-3-8-20(26)16-19-28(36)35(29)33(39)23-9-4-5-10-24(23)34(35)40/h3-19,28-30H,1-2H3/t28?,29-,30+/m0/s1 |
| InChIKey | NZVAGZHYYLOOGZ-YHCMTOLSSA-N |
| XLogP | 5.93 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.60 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|