C36H24F3NO5 — CID 4871568
[4-[1',3'-dioxo-2-[4-(trifluoromethyl)phenyl]spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carbonyl]phenyl] acetate (PubChem CID 4871568) has the molecular formula C36H24F3NO5 and a molecular weight of 607.58 g/mol. Its IUPAC name is [4-[1',3'-dioxo-2-[4-(trifluoromethyl)phenyl]spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carbonyl]phenyl] acetate.
| Compound Name | [4-[1',3'-dioxo-2-[4-(trifluoromethyl)phenyl]spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 4871568 |
| Molecular Formula | C36H24F3NO5 |
| Molecular Weight | 607.58 g/mol |
| Exact Mass | 607.16 |
| IUPAC Name | [4-[1',3'-dioxo-2-[4-(trifluoromethyl)phenyl]spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)C2C(c3ccc(C(F)(F)F)cc3)C3(C(=O)c4ccccc4C3=O)C3C=Cc4ccccc4N23)cc1 |
| InChI | InChI=1S/C36H24F3NO5/c1-20(41)45-25-17-12-23(13-18-25)32(42)31-30(22-10-15-24(16-11-22)36(37,38)39)35(33(43)26-7-3-4-8-27(26)34(35)44)29-19-14-21-6-2-5-9-28(21)40(29)31/h2-19,29-31H,1H3 |
| InChIKey | WOTFNLWOXQSANK-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.58 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|