C24H22N4O6 — CID 41067020
tert-butyl (1R,11R,12S,16R)-14-(4-nitrophenyl)-13,15-dioxo-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxylate (PubChem CID 41067020) has the molecular formula C24H22N4O6 and a molecular weight of 462.46 g/mol. Its IUPAC name is tert-butyl (1R,11R,12S,16R)-14-(4-nitrophenyl)-13,15-dioxo-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxylate.
| Compound Name | tert-butyl (1R,11R,12S,16R)-14-(4-nitrophenyl)-13,15-dioxo-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 41067020 |
| Molecular Formula | C24H22N4O6 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | tert-butyl (1R,11R,12S,16R)-14-(4-nitrophenyl)-13,15-dioxo-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1[C@H]2C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)[C@H]2[C@@H]2c3ccccc3C=NN12 |
| InChI | InChI=1S/C24H22N4O6/c1-24(2,3)34-23(31)20-18-17(19-16-7-5-4-6-13(16)12-25-27(19)20)21(29)26(22(18)30)14-8-10-15(11-9-14)28(32)33/h4-12,17-20H,1-3H3/t17-,18+,19+,20-/m1/s1 |
| InChIKey | POYPEZVXDGKWNN-FUMNGEBKSA-N |
| XLogP | 2.82 |
| TPSA | 122.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|