C21H16FN3O3 — CID 98206695
(1S,11R,12S,16S)-11-acetyl-14-(4-fluorophenyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 98206695) has the molecular formula C21H16FN3O3 and a molecular weight of 377.38 g/mol. Its IUPAC name is (1S,11R,12S,16S)-11-acetyl-14-(4-fluorophenyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1S,11R,12S,16S)-11-acetyl-14-(4-fluorophenyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 98206695 |
| Molecular Formula | C21H16FN3O3 |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | (1S,11R,12S,16S)-11-acetyl-14-(4-fluorophenyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | CC(=O)[C@H]1[C@H]2C(=O)N(c3ccc(F)cc3)C(=O)[C@@H]2[C@H]2c3ccccc3C=NN21 |
| InChI | InChI=1S/C21H16FN3O3/c1-11(26)18-16-17(19-15-5-3-2-4-12(15)10-23-25(18)19)21(28)24(20(16)27)14-8-6-13(22)7-9-14/h2-10,16-19H,1H3/t16-,17-,18-,19+/m0/s1 |
| InChIKey | TZLSRQVOUWGQAQ-CADBVGFASA-N |
| XLogP | 2.29 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|